About butane;1-[4-(2,2-difluoroethyl)phenyl]-3-methyl-5-propan-2-ylpyrazole;3-methylheptane
butane;1-[4-(2,2-difluoroethyl)phenyl]-3-methyl-5-propan-2-ylpyrazole;3-methylheptane (PubChem CID 176921683) has the molecular formula C27H46F2N2
and a molecular weight of 436.68 g/mol. Its IUPAC name is butane;1-[4-(2,2-difluoroethyl)phenyl]-3-methyl-5-propan-2-ylpyrazole;3-methylheptane.
Molecular Properties
| Compound Name | butane;1-[4-(2,2-difluoroethyl)phenyl]-3-methyl-5-propan-2-ylpyrazole;3-methylheptane |
| PubChem CID | 176921683 |
| Molecular Formula | C27H46F2N2 |
| Molecular Weight | 436.68 g/mol |
| Exact Mass | 436.36 |
| IUPAC Name | butane;1-[4-(2,2-difluoroethyl)phenyl]-3-methyl-5-propan-2-ylpyrazole;3-methylheptane |
| SMILES | CCCC.CCCCC(C)CC.Cc1cc(C(C)C)n(-c2ccc(CC(F)F)cc2)n1 |
| InChI | InChI=1S/C15H18F2N2.C8H18.C4H10/c1-10(2)14-8-11(3)18-19(14)13-6-4-12(5-7-13)9-15(16)17;1-4-6-7-8(3)5-2;1-3-4-2/h4-8,10,15H,9H2,1-3H3;8H,4-7H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | IQRVVHDTAGWOGS-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.68 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butane;1-[4-(2,2-difluoroethyl)phenyl]-3-methyl-5-propan-2-ylpyrazole;3-methylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;1-[4-(2,2-difluoroethyl)phenyl]-3-methyl-5-propan-2-ylpyrazole;3-methylheptane?
The IUPAC name of butane;1-[4-(2,2-difluoroethyl)phenyl]-3-methyl-5-propan-2-ylpyrazole;3-methylheptane (CID 176921683) is butane;1-[4-(2,2-difluoroethyl)phenyl]-3-methyl-5-propan-2-ylpyrazole;3-methylheptane.
What is the SMILES notation for butane;1-[4-(2,2-difluoroethyl)phenyl]-3-methyl-5-propan-2-ylpyrazole;3-methylheptane?
The canonical SMILES for butane;1-[4-(2,2-difluoroethyl)phenyl]-3-methyl-5-propan-2-ylpyrazole;3-methylheptane is CCCC.CCCCC(C)CC.Cc1cc(C(C)C)n(-c2ccc(CC(F)F)cc2)n1.
What is the InChIKey of butane;1-[4-(2,2-difluoroethyl)phenyl]-3-methyl-5-propan-2-ylpyrazole;3-methylheptane?
The InChIKey is IQRVVHDTAGWOGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F2N2.C8H18.C4H10/c1-10(2)14-8-11(3)18-19(14)13-6-4-12(5-7-13)9-15(16)17;1-4-6-7-8(3)5-2;1-3-4-2/h4-8,10,15H,9H2,1-3H3;8H,4-7H2,1-3H3;3-4H2,1-2H3.
What are the key properties of butane;1-[4-(2,2-difluoroethyl)phenyl]-3-methyl-5-propan-2-ylpyrazole;3-methylheptane?
butane;1-[4-(2,2-difluoroethyl)phenyl]-3-methyl-5-propan-2-ylpyrazole;3-methylheptane has a molecular weight of 436.68 g/mol, XLogP of 9.14, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;1-[4-(2,2-difluoroethyl)phenyl]-3-methyl-5-propan-2-ylpyrazole;3-methylheptane is sourced from PubChem (CID 176921683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).