C29H42F2N2O3 — CID 176922412
4-(1,1-difluoroethoxy)-N-methyl-N-[(2Z,4Z)-4-[[7-(oxan-4-yl)-7-azaspiro[3.5]nonan-2-yl]oxy]hepta-2,4-dien-2-yl]aniline (PubChem CID 176922412) has the molecular formula C29H42F2N2O3 and a molecular weight of 504.66 g/mol. Its IUPAC name is 4-(1,1-difluoroethoxy)-N-methyl-N-[(2Z,4Z)-4-[[7-(oxan-4-yl)-7-azaspiro[3.5]nonan-2-yl]oxy]hepta-2,4-dien-2-yl]aniline.
| Compound Name | 4-(1,1-difluoroethoxy)-N-methyl-N-[(2Z,4Z)-4-[[7-(oxan-4-yl)-7-azaspiro[3.5]nonan-2-yl]oxy]hepta-2,4-dien-2-yl]aniline |
|---|---|
| PubChem CID | 176922412 |
| Molecular Formula | C29H42F2N2O3 |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.32 |
| IUPAC Name | 4-(1,1-difluoroethoxy)-N-methyl-N-[(2Z,4Z)-4-[[7-(oxan-4-yl)-7-azaspiro[3.5]nonan-2-yl]oxy]hepta-2,4-dien-2-yl]aniline |
| SMILES | CC/C=C(/C=C(/C)N(C)c1ccc(OC(C)(F)F)cc1)OC1CC2(CCN(C3CCOCC3)CC2)C1 |
| InChI | InChI=1S/C29H42F2N2O3/c1-5-6-26(19-22(2)32(4)23-7-9-25(10-8-23)36-28(3,30)31)35-27-20-29(21-27)13-15-33(16-14-29)24-11-17-34-18-12-24/h6-10,19,24,27H,5,11-18,20-21H2,1-4H3/b22-19-,26-6- |
| InChIKey | PMFMFCCVAJBUCG-ZNDUSZSUSA-N |
| XLogP | 6.75 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|