About (2Z)-N-methyl-1,4-bis(methylimino)hexa-2,5-dien-2-amine
(2Z)-N-methyl-1,4-bis(methylimino)hexa-2,5-dien-2-amine (PubChem CID 176922641) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is (2Z)-N-methyl-1,4-bis(methylimino)hexa-2,5-dien-2-amine.
Molecular Properties
| Compound Name | (2Z)-N-methyl-1,4-bis(methylimino)hexa-2,5-dien-2-amine |
| PubChem CID | 176922641 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | (2Z)-N-methyl-1,4-bis(methylimino)hexa-2,5-dien-2-amine |
| SMILES | C=CC(/C=C(/C=N/C)NC)=N\C |
| InChI | InChI=1S/C9H15N3/c1-5-8(11-3)6-9(12-4)7-10-2/h5-7,12H,1H2,2-4H3/b9-6-,10-7+,11-8+ |
| InChIKey | RCTUQRSNQPCYOC-BCPVTWBXSA-N |
| XLogP | 1.05 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-N-methyl-1,4-bis(methylimino)hexa-2,5-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-N-methyl-1,4-bis(methylimino)hexa-2,5-dien-2-amine?
The IUPAC name of (2Z)-N-methyl-1,4-bis(methylimino)hexa-2,5-dien-2-amine (CID 176922641) is (2Z)-N-methyl-1,4-bis(methylimino)hexa-2,5-dien-2-amine.
What is the SMILES notation for (2Z)-N-methyl-1,4-bis(methylimino)hexa-2,5-dien-2-amine?
The canonical SMILES for (2Z)-N-methyl-1,4-bis(methylimino)hexa-2,5-dien-2-amine is C=CC(/C=C(/C=N/C)NC)=N\C.
What is the InChIKey of (2Z)-N-methyl-1,4-bis(methylimino)hexa-2,5-dien-2-amine?
The InChIKey is RCTUQRSNQPCYOC-BCPVTWBXSA-N. The full InChI is InChI=1S/C9H15N3/c1-5-8(11-3)6-9(12-4)7-10-2/h5-7,12H,1H2,2-4H3/b9-6-,10-7+,11-8+.
What are the key properties of (2Z)-N-methyl-1,4-bis(methylimino)hexa-2,5-dien-2-amine?
(2Z)-N-methyl-1,4-bis(methylimino)hexa-2,5-dien-2-amine has a molecular weight of 165.24 g/mol, XLogP of 1.05, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-N-methyl-1,4-bis(methylimino)hexa-2,5-dien-2-amine is sourced from PubChem (CID 176922641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).