About 2-butyl-7,7-difluoro-5-oxa-2-azaspiro[3.4]octane
2-butyl-7,7-difluoro-5-oxa-2-azaspiro[3.4]octane (PubChem CID 176923228) has the molecular formula C10H17F2NO
and a molecular weight of 205.25 g/mol. Its IUPAC name is 2-butyl-7,7-difluoro-5-oxa-2-azaspiro[3.4]octane.
Molecular Properties
| Compound Name | 2-butyl-7,7-difluoro-5-oxa-2-azaspiro[3.4]octane |
| PubChem CID | 176923228 |
| Molecular Formula | C10H17F2NO |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 2-butyl-7,7-difluoro-5-oxa-2-azaspiro[3.4]octane |
| SMILES | CCCCN1CC2(C1)CC(F)(F)CO2 |
| InChI | InChI=1S/C10H17F2NO/c1-2-3-4-13-6-9(7-13)5-10(11,12)8-14-9/h2-8H2,1H3 |
| InChIKey | QJAIRNYPEDVAMK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-7,7-difluoro-5-oxa-2-azaspiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-7,7-difluoro-5-oxa-2-azaspiro[3.4]octane?
The IUPAC name of 2-butyl-7,7-difluoro-5-oxa-2-azaspiro[3.4]octane (CID 176923228) is 2-butyl-7,7-difluoro-5-oxa-2-azaspiro[3.4]octane.
What is the SMILES notation for 2-butyl-7,7-difluoro-5-oxa-2-azaspiro[3.4]octane?
The canonical SMILES for 2-butyl-7,7-difluoro-5-oxa-2-azaspiro[3.4]octane is CCCCN1CC2(C1)CC(F)(F)CO2.
What is the InChIKey of 2-butyl-7,7-difluoro-5-oxa-2-azaspiro[3.4]octane?
The InChIKey is QJAIRNYPEDVAMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2NO/c1-2-3-4-13-6-9(7-13)5-10(11,12)8-14-9/h2-8H2,1H3.
What are the key properties of 2-butyl-7,7-difluoro-5-oxa-2-azaspiro[3.4]octane?
2-butyl-7,7-difluoro-5-oxa-2-azaspiro[3.4]octane has a molecular weight of 205.25 g/mol, XLogP of 1.90, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-7,7-difluoro-5-oxa-2-azaspiro[3.4]octane is sourced from PubChem (CID 176923228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).