About CID 176924165
CID 176924165 (PubChem CID 176924165) has the molecular formula C23H39N4O2Pb
and a molecular weight of 610.79 g/mol.
Molecular Properties
| Compound Name | CID 176924165 |
| PubChem CID | 176924165 |
| Molecular Formula | C23H39N4O2Pb |
| Molecular Weight | 610.79 g/mol |
| Exact Mass | 611.28 |
| IUPAC Name | — |
| SMILES | CC.CN(C)C.O=CCCC1c2c(OC3CC4(CNC4)C3)ccnc2CCN1C[Pb] |
| InChI | InChI=1S/C18H24N3O2.C3H9N.C2H6.Pb/c1-21-7-5-14-17(15(21)3-2-8-22)16(4-6-20-14)23-13-9-18(10-13)11-19-12-18;1-4(2)3;1-2;/h4,6,8,13,15,19H,1-3,5,7,9-12H2;1-3H3;1-2H3; |
| InChIKey | GICGNBVVMPEIQU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 610.79 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze CID 176924165 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176924165?
The IUPAC name of CID 176924165 (CID 176924165) is not available.
What is the SMILES notation for CID 176924165?
The canonical SMILES for CID 176924165 is CC.CN(C)C.O=CCCC1c2c(OC3CC4(CNC4)C3)ccnc2CCN1C[Pb].
What is the InChIKey of CID 176924165?
The InChIKey is GICGNBVVMPEIQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N3O2.C3H9N.C2H6.Pb/c1-21-7-5-14-17(15(21)3-2-8-22)16(4-6-20-14)23-13-9-18(10-13)11-19-12-18;1-4(2)3;1-2;/h4,6,8,13,15,19H,1-3,5,7,9-12H2;1-3H3;1-2H3;.
What are the key properties of CID 176924165?
CID 176924165 has a molecular weight of 610.79 g/mol, XLogP of 2.42, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176924165 is sourced from PubChem (CID 176924165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).