C12H23F2NO — CID 176924994
2-butyl-7,7-difluoro-5-oxa-2-azaspiro[3.4]octane;ethane (PubChem CID 176924994) has the molecular formula C12H23F2NO and a molecular weight of 235.32 g/mol. Its IUPAC name is 2-butyl-7,7-difluoro-5-oxa-2-azaspiro[3.4]octane;ethane.
| Compound Name | 2-butyl-7,7-difluoro-5-oxa-2-azaspiro[3.4]octane;ethane |
|---|---|
| PubChem CID | 176924994 |
| Molecular Formula | C12H23F2NO |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 2-butyl-7,7-difluoro-5-oxa-2-azaspiro[3.4]octane;ethane |
| SMILES | CC.CCCCN1CC2(C1)CC(F)(F)CO2 |
| InChI | InChI=1S/C10H17F2NO.C2H6/c1-2-3-4-13-6-9(7-13)5-10(11,12)8-14-9;1-2/h2-8H2,1H3;1-2H3 |
| InChIKey | FZHYDJZLAGGDKH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |