About CID 176925005
CID 176925005 (PubChem CID 176925005) has the molecular formula C22H37N4O2Pb
and a molecular weight of 596.76 g/mol.
Molecular Properties
| Compound Name | CID 176925005 |
| PubChem CID | 176925005 |
| Molecular Formula | C22H37N4O2Pb |
| Molecular Weight | 596.76 g/mol |
| Exact Mass | 597.27 |
| IUPAC Name | — |
| SMILES | CC.CN(C)CCOCC1c2c(OC3CC4(CNC4)C3)ccnc2CCN1C[Pb] |
| InChI | InChI=1S/C20H31N4O2.C2H6.Pb/c1-23(2)8-9-25-12-17-19-16(5-7-24(17)3)22-6-4-18(19)26-15-10-20(11-15)13-21-14-20;1-2;/h4,6,15,17,21H,3,5,7-14H2,1-2H3;1-2H3; |
| InChIKey | BZXDTUPMPDRGHI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 596.76 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 176925005 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176925005?
The IUPAC name of CID 176925005 (CID 176925005) is not available.
What is the SMILES notation for CID 176925005?
The canonical SMILES for CID 176925005 is CC.CN(C)CCOCC1c2c(OC3CC4(CNC4)C3)ccnc2CCN1C[Pb].
What is the InChIKey of CID 176925005?
The InChIKey is BZXDTUPMPDRGHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31N4O2.C2H6.Pb/c1-23(2)8-9-25-12-17-19-16(5-7-24(17)3)22-6-4-18(19)26-15-10-20(11-15)13-21-14-20;1-2;/h4,6,15,17,21H,3,5,7-14H2,1-2H3;1-2H3;.
What are the key properties of CID 176925005?
CID 176925005 has a molecular weight of 596.76 g/mol, XLogP of 1.84, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176925005 is sourced from PubChem (CID 176925005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).