C37H51FN8O4 — CID 176925007
5-fluoro-2-[[5-[4-[[6-[3-(1,4-oxazepan-4-yl)propyl]-7,8-dihydro-5H-1,6-naphthyridin-4-yl]oxy]piperidin-1-yl]-1,2,4-triazin-6-yl]oxy]-N,N-di(propan-2-yl)benzamide (PubChem CID 176925007) has the molecular formula C37H51FN8O4 and a molecular weight of 690.87 g/mol. Its IUPAC name is 5-fluoro-2-[[5-[4-[[6-[3-(1,4-oxazepan-4-yl)propyl]-7,8-dihydro-5H-1,6-naphthyridin-4-yl]oxy]piperidin-1-yl]-1,2,4-triazin-6-yl]oxy]-N,N-di(propan-2-yl)benzamide.
| Compound Name | 5-fluoro-2-[[5-[4-[[6-[3-(1,4-oxazepan-4-yl)propyl]-7,8-dihydro-5H-1,6-naphthyridin-4-yl]oxy]piperidin-1-yl]-1,2,4-triazin-6-yl]oxy]-N,N-di(propan-2-yl)benzamide |
|---|---|
| PubChem CID | 176925007 |
| Molecular Formula | C37H51FN8O4 |
| Molecular Weight | 690.87 g/mol |
| Exact Mass | 690.40 |
| IUPAC Name | 5-fluoro-2-[[5-[4-[[6-[3-(1,4-oxazepan-4-yl)propyl]-7,8-dihydro-5H-1,6-naphthyridin-4-yl]oxy]piperidin-1-yl]-1,2,4-triazin-6-yl]oxy]-N,N-di(propan-2-yl)benzamide |
| SMILES | CC(C)N(C(=O)c1cc(F)ccc1Oc1nncnc1N1CCC(Oc2ccnc3c2CN(CCCN2CCCOCC2)CC3)CC1)C(C)C |
| InChI | InChI=1S/C37H51FN8O4/c1-26(2)46(27(3)4)37(47)30-23-28(38)7-8-33(30)50-36-35(40-25-41-42-36)45-18-10-29(11-19-45)49-34-9-13-39-32-12-17-44(24-31(32)34)15-5-14-43-16-6-21-48-22-20-43/h7-9,13,23,25-27,29H,5-6,10-12,14-22,24H2,1-4H3 |
| InChIKey | VUZFUUQCUQSWCN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 109.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.87 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |