About 1-N'-[[6-[6-(aminomethyl)-3-pyridinyl]-5-chloro-1H-indol-2-yl]methyl]ethene-1,1-diamine
1-N'-[[6-[6-(aminomethyl)-3-pyridinyl]-5-chloro-1H-indol-2-yl]methyl]ethene-1,1-diamine (PubChem CID 176925757) has the molecular formula C17H18ClN5
and a molecular weight of 327.82 g/mol. Its IUPAC name is 1-N'-[[6-[6-(aminomethyl)-3-pyridinyl]-5-chloro-1H-indol-2-yl]methyl]ethene-1,1-diamine.
Molecular Properties
| Compound Name | 1-N'-[[6-[6-(aminomethyl)-3-pyridinyl]-5-chloro-1H-indol-2-yl]methyl]ethene-1,1-diamine |
| PubChem CID | 176925757 |
| Molecular Formula | C17H18ClN5 |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 1-N'-[[6-[6-(aminomethyl)-3-pyridinyl]-5-chloro-1H-indol-2-yl]methyl]ethene-1,1-diamine |
| SMILES | C=C(N)NCc1cc2cc(Cl)c(-c3ccc(CN)nc3)cc2[nH]1 |
| InChI | InChI=1S/C17H18ClN5/c1-10(20)21-9-14-4-12-5-16(18)15(6-17(12)23-14)11-2-3-13(7-19)22-8-11/h2-6,8,21,23H,1,7,9,19-20H2 |
| InChIKey | CBRUMEXODQJDLM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-N'-[[6-[6-(aminomethyl)-3-pyridinyl]-5-chloro-1H-indol-2-yl]methyl]ethene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N'-[[6-[6-(aminomethyl)-3-pyridinyl]-5-chloro-1H-indol-2-yl]methyl]ethene-1,1-diamine?
The IUPAC name of 1-N'-[[6-[6-(aminomethyl)-3-pyridinyl]-5-chloro-1H-indol-2-yl]methyl]ethene-1,1-diamine (CID 176925757) is 1-N'-[[6-[6-(aminomethyl)-3-pyridinyl]-5-chloro-1H-indol-2-yl]methyl]ethene-1,1-diamine.
What is the SMILES notation for 1-N'-[[6-[6-(aminomethyl)-3-pyridinyl]-5-chloro-1H-indol-2-yl]methyl]ethene-1,1-diamine?
The canonical SMILES for 1-N'-[[6-[6-(aminomethyl)-3-pyridinyl]-5-chloro-1H-indol-2-yl]methyl]ethene-1,1-diamine is C=C(N)NCc1cc2cc(Cl)c(-c3ccc(CN)nc3)cc2[nH]1.
What is the InChIKey of 1-N'-[[6-[6-(aminomethyl)-3-pyridinyl]-5-chloro-1H-indol-2-yl]methyl]ethene-1,1-diamine?
The InChIKey is CBRUMEXODQJDLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18ClN5/c1-10(20)21-9-14-4-12-5-16(18)15(6-17(12)23-14)11-2-3-13(7-19)22-8-11/h2-6,8,21,23H,1,7,9,19-20H2.
What are the key properties of 1-N'-[[6-[6-(aminomethyl)-3-pyridinyl]-5-chloro-1H-indol-2-yl]methyl]ethene-1,1-diamine?
1-N'-[[6-[6-(aminomethyl)-3-pyridinyl]-5-chloro-1H-indol-2-yl]methyl]ethene-1,1-diamine has a molecular weight of 327.82 g/mol, XLogP of 2.86, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N'-[[6-[6-(aminomethyl)-3-pyridinyl]-5-chloro-1H-indol-2-yl]methyl]ethene-1,1-diamine is sourced from PubChem (CID 176925757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).