C17H28N4O — CID 176926992
4-methyl-3-[N-(3-methylbut-1-en-2-yl)-C-propan-2-ylcarbonimidoyl]-2,6,7,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-1-one (PubChem CID 176926992) has the molecular formula C17H28N4O and a molecular weight of 304.44 g/mol. Its IUPAC name is 4-methyl-3-[N-(3-methylbut-1-en-2-yl)-C-propan-2-ylcarbonimidoyl]-2,6,7,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-1-one.
| Compound Name | 4-methyl-3-[N-(3-methylbut-1-en-2-yl)-C-propan-2-ylcarbonimidoyl]-2,6,7,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-1-one |
|---|---|
| PubChem CID | 176926992 |
| Molecular Formula | C17H28N4O |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | 4-methyl-3-[N-(3-methylbut-1-en-2-yl)-C-propan-2-ylcarbonimidoyl]-2,6,7,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-1-one |
| SMILES | C=C(/N=C(/C1=C(C)N2CCNCC2C(=O)N1)C(C)C)C(C)C |
| InChI | InChI=1S/C17H28N4O/c1-10(2)12(5)19-15(11(3)4)16-13(6)21-8-7-18-9-14(21)17(22)20-16/h10-11,14,18H,5,7-9H2,1-4,6H3,(H,20,22)/b19-15+ |
| InChIKey | XYYLJQCDPYIKIF-XDJHFCHBSA-N |
| XLogP | 1.89 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|