C12H13N5S — CID 176927390
5-[(6-ethyl-2-methylpurin-9-yl)methyl]-1,3-thiazole (PubChem CID 176927390) has the molecular formula C12H13N5S and a molecular weight of 259.34 g/mol. Its IUPAC name is 5-[(6-ethyl-2-methylpurin-9-yl)methyl]-1,3-thiazole.
| Compound Name | 5-[(6-ethyl-2-methylpurin-9-yl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 176927390 |
| Molecular Formula | C12H13N5S |
| Molecular Weight | 259.34 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 5-[(6-ethyl-2-methylpurin-9-yl)methyl]-1,3-thiazole |
| SMILES | CCc1nc(C)nc2c1ncn2Cc1cncs1 |
| InChI | InChI=1S/C12H13N5S/c1-3-10-11-12(16-8(2)15-10)17(6-14-11)5-9-4-13-7-18-9/h4,6-7H,3,5H2,1-2H3 |
| InChIKey | KRMDPDFLOHVWDA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |