C15H25N3O — CID 176927606
ethane;2-methyl-4-propan-2-yl-5,6,7,9-tetrahydropyrimido[4,5-c]azepine-8-carbaldehyde (PubChem CID 176927606) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is ethane;2-methyl-4-propan-2-yl-5,6,7,9-tetrahydropyrimido[4,5-c]azepine-8-carbaldehyde.
| Compound Name | ethane;2-methyl-4-propan-2-yl-5,6,7,9-tetrahydropyrimido[4,5-c]azepine-8-carbaldehyde |
|---|---|
| PubChem CID | 176927606 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | ethane;2-methyl-4-propan-2-yl-5,6,7,9-tetrahydropyrimido[4,5-c]azepine-8-carbaldehyde |
| SMILES | CC.Cc1nc2c(c(C(C)C)n1)CCCN(C=O)C2 |
| InChI | InChI=1S/C13H19N3O.C2H6/c1-9(2)13-11-5-4-6-16(8-17)7-12(11)14-10(3)15-13;1-2/h8-9H,4-7H2,1-3H3;1-2H3 |
| InChIKey | XSTQOHNSBSXRAL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|