C21H36F2N2O2 — CID 176927787
(2R)-8-(ethoxymethyl)-2-fluoro-5-[2-[[(2R,8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]propyl]-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 176927787) has the molecular formula C21H36F2N2O2 and a molecular weight of 386.53 g/mol. Its IUPAC name is (2R)-8-(ethoxymethyl)-2-fluoro-5-[2-[[(2R,8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]propyl]-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | (2R)-8-(ethoxymethyl)-2-fluoro-5-[2-[[(2R,8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]propyl]-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 176927787 |
| Molecular Formula | C21H36F2N2O2 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | (2R)-8-(ethoxymethyl)-2-fluoro-5-[2-[[(2R,8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]propyl]-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | CCOCC12CCC(CC(C)OC[C@]34CCCN3C[C@H](F)C4)N1C[C@H](F)C2 |
| InChI | InChI=1S/C21H36F2N2O2/c1-3-26-14-21-7-5-19(25(21)13-18(23)11-21)9-16(2)27-15-20-6-4-8-24(20)12-17(22)10-20/h16-19H,3-15H2,1-2H3/t16?,17-,18-,19?,20-,21?/m1/s1 |
| InChIKey | HDDWTYZLFZKZII-FUDGHYGOSA-N |
| XLogP | 3.34 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |