C12H18FN — CID 176928626
(2E,4E,6Z)-4-fluoro-3-methylundeca-2,4,6-trien-1-imine (PubChem CID 176928626) has the molecular formula C12H18FN and a molecular weight of 195.28 g/mol. Its IUPAC name is (2E,4E,6Z)-4-fluoro-3-methylundeca-2,4,6-trien-1-imine.
| Compound Name | (2E,4E,6Z)-4-fluoro-3-methylundeca-2,4,6-trien-1-imine |
|---|---|
| PubChem CID | 176928626 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | (2E,4E,6Z)-4-fluoro-3-methylundeca-2,4,6-trien-1-imine |
| SMILES | [H]/N=C/C=C(C)/C(F)=C\C=C/CCCC |
| InChI | InChI=1S/C12H18FN/c1-3-4-5-6-7-8-12(13)11(2)9-10-14/h6-10,14H,3-5H2,1-2H3/b7-6-,11-9+,12-8+,14-10+ |
| InChIKey | WHSDMLRERNHJNP-BSKPWYJJSA-N |
| XLogP | 4.18 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|