C27H44 — CID 176928992
(2S,5S,10S)-11-methyl-5-[(2R)-6-methylheptan-2-yl]pentacyclo[8.8.0.02,7.05,7.011,16]octadec-16-ene (PubChem CID 176928992) has the molecular formula C27H44 and a molecular weight of 368.65 g/mol. Its IUPAC name is (2S,5S,10S)-11-methyl-5-[(2R)-6-methylheptan-2-yl]pentacyclo[8.8.0.02,7.05,7.011,16]octadec-16-ene.
| Compound Name | (2S,5S,10S)-11-methyl-5-[(2R)-6-methylheptan-2-yl]pentacyclo[8.8.0.02,7.05,7.011,16]octadec-16-ene |
|---|---|
| PubChem CID | 176928992 |
| Molecular Formula | C27H44 |
| Molecular Weight | 368.65 g/mol |
| Exact Mass | 368.34 |
| IUPAC Name | (2S,5S,10S)-11-methyl-5-[(2R)-6-methylheptan-2-yl]pentacyclo[8.8.0.02,7.05,7.011,16]octadec-16-ene |
| SMILES | CC(C)CCC[C@@H](C)[C@@]12CC[C@H]3C4CC=C5CCCCC5(C)[C@H]4CCC31C2 |
| InChI | InChI=1S/C27H44/c1-19(2)8-7-9-20(3)26-16-14-24-22-12-11-21-10-5-6-15-25(21,4)23(22)13-17-27(24,26)18-26/h11,19-20,22-24H,5-10,12-18H2,1-4H3/t20-,22?,23+,24+,25?,26+,27?/m1/s1 |
| InChIKey | CWVYUMWNPPWMCP-UIHUNHTMSA-N |
| XLogP | 8.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.65 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|