C11H18O — CID 176929125
ethane;6-methyl-1,3,4,5-tetrahydro-2-benzofuran (PubChem CID 176929125) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is ethane;6-methyl-1,3,4,5-tetrahydro-2-benzofuran.
| Compound Name | ethane;6-methyl-1,3,4,5-tetrahydro-2-benzofuran |
|---|---|
| PubChem CID | 176929125 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | ethane;6-methyl-1,3,4,5-tetrahydro-2-benzofuran |
| SMILES | CC.CC1=CC2=C(CC1)COC2 |
| InChI | InChI=1S/C9H12O.C2H6/c1-7-2-3-8-5-10-6-9(8)4-7;1-2/h4H,2-3,5-6H2,1H3;1-2H3 |
| InChIKey | XUXUSJISCFPTRT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |