About 5-iodo-1,1,3,3-tetramethyl-2-benzofuran
5-iodo-1,1,3,3-tetramethyl-2-benzofuran (PubChem CID 176929378) has the molecular formula C12H15IO
and a molecular weight of 302.15 g/mol. Its IUPAC name is 5-iodo-1,1,3,3-tetramethyl-2-benzofuran.
Molecular Properties
| Compound Name | 5-iodo-1,1,3,3-tetramethyl-2-benzofuran |
| PubChem CID | 176929378 |
| Molecular Formula | C12H15IO |
| Molecular Weight | 302.15 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 5-iodo-1,1,3,3-tetramethyl-2-benzofuran |
| SMILES | CC1(C)OC(C)(C)c2cc(I)ccc21 |
| InChI | InChI=1S/C12H15IO/c1-11(2)9-6-5-8(13)7-10(9)12(3,4)14-11/h5-7H,1-4H3 |
| InChIKey | LGDCAUAAKAYXOS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.15 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-1,1,3,3-tetramethyl-2-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-1,1,3,3-tetramethyl-2-benzofuran?
The IUPAC name of 5-iodo-1,1,3,3-tetramethyl-2-benzofuran (CID 176929378) is 5-iodo-1,1,3,3-tetramethyl-2-benzofuran.
What is the SMILES notation for 5-iodo-1,1,3,3-tetramethyl-2-benzofuran?
The canonical SMILES for 5-iodo-1,1,3,3-tetramethyl-2-benzofuran is CC1(C)OC(C)(C)c2cc(I)ccc21.
What is the InChIKey of 5-iodo-1,1,3,3-tetramethyl-2-benzofuran?
The InChIKey is LGDCAUAAKAYXOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15IO/c1-11(2)9-6-5-8(13)7-10(9)12(3,4)14-11/h5-7H,1-4H3.
What are the key properties of 5-iodo-1,1,3,3-tetramethyl-2-benzofuran?
5-iodo-1,1,3,3-tetramethyl-2-benzofuran has a molecular weight of 302.15 g/mol, XLogP of 3.79, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-1,1,3,3-tetramethyl-2-benzofuran is sourced from PubChem (CID 176929378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).