About N-[6-chloro-4-(1,1-difluoroethyl)cyclohexa-1,5-dien-1-yl]acetamide
N-[6-chloro-4-(1,1-difluoroethyl)cyclohexa-1,5-dien-1-yl]acetamide (PubChem CID 176929617) has the molecular formula C10H12ClF2NO
and a molecular weight of 235.66 g/mol. Its IUPAC name is N-[6-chloro-4-(1,1-difluoroethyl)cyclohexa-1,5-dien-1-yl]acetamide.
Molecular Properties
| Compound Name | N-[6-chloro-4-(1,1-difluoroethyl)cyclohexa-1,5-dien-1-yl]acetamide |
| PubChem CID | 176929617 |
| Molecular Formula | C10H12ClF2NO |
| Molecular Weight | 235.66 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | N-[6-chloro-4-(1,1-difluoroethyl)cyclohexa-1,5-dien-1-yl]acetamide |
| SMILES | CC(=O)NC1=CCC(C(C)(F)F)C=C1Cl |
| InChI | InChI=1S/C10H12ClF2NO/c1-6(15)14-9-4-3-7(5-8(9)11)10(2,12)13/h4-5,7H,3H2,1-2H3,(H,14,15) |
| InChIKey | WXIKKNNEHOLPPH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.66 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[6-chloro-4-(1,1-difluoroethyl)cyclohexa-1,5-dien-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-chloro-4-(1,1-difluoroethyl)cyclohexa-1,5-dien-1-yl]acetamide?
The IUPAC name of N-[6-chloro-4-(1,1-difluoroethyl)cyclohexa-1,5-dien-1-yl]acetamide (CID 176929617) is N-[6-chloro-4-(1,1-difluoroethyl)cyclohexa-1,5-dien-1-yl]acetamide.
What is the SMILES notation for N-[6-chloro-4-(1,1-difluoroethyl)cyclohexa-1,5-dien-1-yl]acetamide?
The canonical SMILES for N-[6-chloro-4-(1,1-difluoroethyl)cyclohexa-1,5-dien-1-yl]acetamide is CC(=O)NC1=CCC(C(C)(F)F)C=C1Cl.
What is the InChIKey of N-[6-chloro-4-(1,1-difluoroethyl)cyclohexa-1,5-dien-1-yl]acetamide?
The InChIKey is WXIKKNNEHOLPPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClF2NO/c1-6(15)14-9-4-3-7(5-8(9)11)10(2,12)13/h4-5,7H,3H2,1-2H3,(H,14,15).
What are the key properties of N-[6-chloro-4-(1,1-difluoroethyl)cyclohexa-1,5-dien-1-yl]acetamide?
N-[6-chloro-4-(1,1-difluoroethyl)cyclohexa-1,5-dien-1-yl]acetamide has a molecular weight of 235.66 g/mol, XLogP of 2.80, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-chloro-4-(1,1-difluoroethyl)cyclohexa-1,5-dien-1-yl]acetamide is sourced from PubChem (CID 176929617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).