About (1R)-5-iodo-1-methoxy-2,3-dihydro-1H-indene
(1R)-5-iodo-1-methoxy-2,3-dihydro-1H-indene (PubChem CID 176929623) has the molecular formula C10H11IO
and a molecular weight of 274.10 g/mol. Its IUPAC name is (1R)-5-iodo-1-methoxy-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | (1R)-5-iodo-1-methoxy-2,3-dihydro-1H-indene |
| PubChem CID | 176929623 |
| Molecular Formula | C10H11IO |
| Molecular Weight | 274.10 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | (1R)-5-iodo-1-methoxy-2,3-dihydro-1H-indene |
| SMILES | CO[C@@H]1CCc2cc(I)ccc21 |
| InChI | InChI=1S/C10H11IO/c1-12-10-5-2-7-6-8(11)3-4-9(7)10/h3-4,6,10H,2,5H2,1H3/t10-/m1/s1 |
| InChIKey | GDFJZKJWOXYRRX-SNVBAGLBSA-N |
| XLogP | 2.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.10 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (1R)-5-iodo-1-methoxy-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-5-iodo-1-methoxy-2,3-dihydro-1H-indene?
The IUPAC name of (1R)-5-iodo-1-methoxy-2,3-dihydro-1H-indene (CID 176929623) is (1R)-5-iodo-1-methoxy-2,3-dihydro-1H-indene.
What is the SMILES notation for (1R)-5-iodo-1-methoxy-2,3-dihydro-1H-indene?
The canonical SMILES for (1R)-5-iodo-1-methoxy-2,3-dihydro-1H-indene is CO[C@@H]1CCc2cc(I)ccc21.
What is the InChIKey of (1R)-5-iodo-1-methoxy-2,3-dihydro-1H-indene?
The InChIKey is GDFJZKJWOXYRRX-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H11IO/c1-12-10-5-2-7-6-8(11)3-4-9(7)10/h3-4,6,10H,2,5H2,1H3/t10-/m1/s1.
What are the key properties of (1R)-5-iodo-1-methoxy-2,3-dihydro-1H-indene?
(1R)-5-iodo-1-methoxy-2,3-dihydro-1H-indene has a molecular weight of 274.10 g/mol, XLogP of 2.92, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-5-iodo-1-methoxy-2,3-dihydro-1H-indene is sourced from PubChem (CID 176929623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).