About 5-fluoro-3-methyl-1,4-di(propan-2-yl)indazole
5-fluoro-3-methyl-1,4-di(propan-2-yl)indazole (PubChem CID 176932144) has the molecular formula C14H19FN2
and a molecular weight of 234.32 g/mol. Its IUPAC name is 5-fluoro-3-methyl-1,4-di(propan-2-yl)indazole.
Molecular Properties
| Compound Name | 5-fluoro-3-methyl-1,4-di(propan-2-yl)indazole |
| PubChem CID | 176932144 |
| Molecular Formula | C14H19FN2 |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 5-fluoro-3-methyl-1,4-di(propan-2-yl)indazole |
| SMILES | Cc1nn(C(C)C)c2ccc(F)c(C(C)C)c12 |
| InChI | InChI=1S/C14H19FN2/c1-8(2)13-11(15)6-7-12-14(13)10(5)16-17(12)9(3)4/h6-9H,1-5H3 |
| InChIKey | JAWVVBVKGNIAMW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-3-methyl-1,4-di(propan-2-yl)indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3-methyl-1,4-di(propan-2-yl)indazole?
The IUPAC name of 5-fluoro-3-methyl-1,4-di(propan-2-yl)indazole (CID 176932144) is 5-fluoro-3-methyl-1,4-di(propan-2-yl)indazole.
What is the SMILES notation for 5-fluoro-3-methyl-1,4-di(propan-2-yl)indazole?
The canonical SMILES for 5-fluoro-3-methyl-1,4-di(propan-2-yl)indazole is Cc1nn(C(C)C)c2ccc(F)c(C(C)C)c12.
What is the InChIKey of 5-fluoro-3-methyl-1,4-di(propan-2-yl)indazole?
The InChIKey is JAWVVBVKGNIAMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19FN2/c1-8(2)13-11(15)6-7-12-14(13)10(5)16-17(12)9(3)4/h6-9H,1-5H3.
What are the key properties of 5-fluoro-3-methyl-1,4-di(propan-2-yl)indazole?
5-fluoro-3-methyl-1,4-di(propan-2-yl)indazole has a molecular weight of 234.32 g/mol, XLogP of 4.19, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3-methyl-1,4-di(propan-2-yl)indazole is sourced from PubChem (CID 176932144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).