C26H28ClF3N4O2 — CID 176932588
3-[6-[4-[4-(4-chloro-2,3-difluorophenyl)piperidin-1-yl]piperidin-1-yl]-5-fluoro-3-pyridinyl]piperidine-2,6-dione (PubChem CID 176932588) has the molecular formula C26H28ClF3N4O2 and a molecular weight of 520.98 g/mol. Its IUPAC name is 3-[6-[4-[4-(4-chloro-2,3-difluorophenyl)piperidin-1-yl]piperidin-1-yl]-5-fluoro-3-pyridinyl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[4-(4-chloro-2,3-difluorophenyl)piperidin-1-yl]piperidin-1-yl]-5-fluoro-3-pyridinyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176932588 |
| Molecular Formula | C26H28ClF3N4O2 |
| Molecular Weight | 520.98 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | 3-[6-[4-[4-(4-chloro-2,3-difluorophenyl)piperidin-1-yl]piperidin-1-yl]-5-fluoro-3-pyridinyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2cnc(N3CCC(N4CCC(c5ccc(Cl)c(F)c5F)CC4)CC3)c(F)c2)C(=O)N1 |
| InChI | InChI=1S/C26H28ClF3N4O2/c27-20-3-1-18(23(29)24(20)30)15-5-9-33(10-6-15)17-7-11-34(12-8-17)25-21(28)13-16(14-31-25)19-2-4-22(35)32-26(19)36/h1,3,13-15,17,19H,2,4-12H2,(H,32,35,36) |
| InChIKey | YEFUWRQASDTGFH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.98 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|