C23H28N6O2 — CID 176933015
N,N,1,7-tetramethyl-2-[1-[3-(triazol-1-yl)propanoyl]-3,6-dihydro-2H-pyridin-5-yl]indole-5-carboxamide (PubChem CID 176933015) has the molecular formula C23H28N6O2 and a molecular weight of 420.52 g/mol. Its IUPAC name is N,N,1,7-tetramethyl-2-[1-[3-(triazol-1-yl)propanoyl]-3,6-dihydro-2H-pyridin-5-yl]indole-5-carboxamide.
| Compound Name | N,N,1,7-tetramethyl-2-[1-[3-(triazol-1-yl)propanoyl]-3,6-dihydro-2H-pyridin-5-yl]indole-5-carboxamide |
|---|---|
| PubChem CID | 176933015 |
| Molecular Formula | C23H28N6O2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | N,N,1,7-tetramethyl-2-[1-[3-(triazol-1-yl)propanoyl]-3,6-dihydro-2H-pyridin-5-yl]indole-5-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)C)cc2cc(C3=CCCN(C(=O)CCn4ccnn4)C3)n(C)c12 |
| InChI | InChI=1S/C23H28N6O2/c1-16-12-19(23(31)26(2)3)13-18-14-20(27(4)22(16)18)17-6-5-9-28(15-17)21(30)7-10-29-11-8-24-25-29/h6,8,11-14H,5,7,9-10,15H2,1-4H3 |
| InChIKey | MVJHSTPVSQJVPZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 76.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|