C12H15NOS — CID 176933057
2-(4-methylphenyl)pyrrolidine-1-carbothioic S-acid (PubChem CID 176933057) has the molecular formula C12H15NOS and a molecular weight of 221.33 g/mol. Its IUPAC name is 2-(4-methylphenyl)pyrrolidine-1-carbothioic S-acid.
| Compound Name | 2-(4-methylphenyl)pyrrolidine-1-carbothioic S-acid |
|---|---|
| PubChem CID | 176933057 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 2-(4-methylphenyl)pyrrolidine-1-carbothioic S-acid |
| SMILES | Cc1ccc(C2CCCN2C(=O)S)cc1 |
| InChI | InChI=1S/C12H15NOS/c1-9-4-6-10(7-5-9)11-3-2-8-13(11)12(14)15/h4-7,11H,2-3,8H2,1H3,(H,14,15) |
| InChIKey | VEBFBCPTEFBMNI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|