About N,N-dimethyl-7-piperidin-4-yl-5-propan-2-yl-1-benzofuran-2-carboxamide;molecular hydrogen
N,N-dimethyl-7-piperidin-4-yl-5-propan-2-yl-1-benzofuran-2-carboxamide;molecular hydrogen (PubChem CID 176934009) has the molecular formula C19H28N2O2
and a molecular weight of 316.45 g/mol. Its IUPAC name is N,N-dimethyl-7-piperidin-4-yl-5-propan-2-yl-1-benzofuran-2-carboxamide;molecular hydrogen.
Molecular Properties
| Compound Name | N,N-dimethyl-7-piperidin-4-yl-5-propan-2-yl-1-benzofuran-2-carboxamide;molecular hydrogen |
| PubChem CID | 176934009 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | N,N-dimethyl-7-piperidin-4-yl-5-propan-2-yl-1-benzofuran-2-carboxamide;molecular hydrogen |
| SMILES | CC(C)c1cc(C2CCNCC2)c2oc(C(=O)N(C)C)cc2c1.[H][H] |
| InChI | InChI=1S/C19H26N2O2.H2/c1-12(2)14-9-15-11-17(19(22)21(3)4)23-18(15)16(10-14)13-5-7-20-8-6-13;/h9-13,20H,5-8H2,1-4H3;1H |
| InChIKey | PEDZPGSWIHUKQI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-dimethyl-7-piperidin-4-yl-5-propan-2-yl-1-benzofuran-2-carboxamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-7-piperidin-4-yl-5-propan-2-yl-1-benzofuran-2-carboxamide;molecular hydrogen?
The IUPAC name of N,N-dimethyl-7-piperidin-4-yl-5-propan-2-yl-1-benzofuran-2-carboxamide;molecular hydrogen (CID 176934009) is N,N-dimethyl-7-piperidin-4-yl-5-propan-2-yl-1-benzofuran-2-carboxamide;molecular hydrogen.
What is the SMILES notation for N,N-dimethyl-7-piperidin-4-yl-5-propan-2-yl-1-benzofuran-2-carboxamide;molecular hydrogen?
The canonical SMILES for N,N-dimethyl-7-piperidin-4-yl-5-propan-2-yl-1-benzofuran-2-carboxamide;molecular hydrogen is CC(C)c1cc(C2CCNCC2)c2oc(C(=O)N(C)C)cc2c1.[H][H].
What is the InChIKey of N,N-dimethyl-7-piperidin-4-yl-5-propan-2-yl-1-benzofuran-2-carboxamide;molecular hydrogen?
The InChIKey is PEDZPGSWIHUKQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O2.H2/c1-12(2)14-9-15-11-17(19(22)21(3)4)23-18(15)16(10-14)13-5-7-20-8-6-13;/h9-13,20H,5-8H2,1-4H3;1H.
What are the key properties of N,N-dimethyl-7-piperidin-4-yl-5-propan-2-yl-1-benzofuran-2-carboxamide;molecular hydrogen?
N,N-dimethyl-7-piperidin-4-yl-5-propan-2-yl-1-benzofuran-2-carboxamide;molecular hydrogen has a molecular weight of 316.45 g/mol, XLogP of 3.97, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-7-piperidin-4-yl-5-propan-2-yl-1-benzofuran-2-carboxamide;molecular hydrogen is sourced from PubChem (CID 176934009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).