C11H19NS — CID 176934064
3-methyl-2-propan-2-yl-3a,6,7,7a-tetrahydro-2H-1,3-benzothiazole (PubChem CID 176934064) has the molecular formula C11H19NS and a molecular weight of 197.35 g/mol. Its IUPAC name is 3-methyl-2-propan-2-yl-3a,6,7,7a-tetrahydro-2H-1,3-benzothiazole.
| Compound Name | 3-methyl-2-propan-2-yl-3a,6,7,7a-tetrahydro-2H-1,3-benzothiazole |
|---|---|
| PubChem CID | 176934064 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 3-methyl-2-propan-2-yl-3a,6,7,7a-tetrahydro-2H-1,3-benzothiazole |
| SMILES | CC(C)C1SC2CCC=CC2N1C |
| InChI | InChI=1S/C11H19NS/c1-8(2)11-12(3)9-6-4-5-7-10(9)13-11/h4,6,8-11H,5,7H2,1-3H3 |
| InChIKey | UZJZCMNQHSXNCL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|