C11H25F2N — CID 176934425
2,2-difluoro-N,N,3,4-tetramethylpentan-1-amine;ethane (PubChem CID 176934425) has the molecular formula C11H25F2N and a molecular weight of 209.32 g/mol. Its IUPAC name is 2,2-difluoro-N,N,3,4-tetramethylpentan-1-amine;ethane.
| Compound Name | 2,2-difluoro-N,N,3,4-tetramethylpentan-1-amine;ethane |
|---|---|
| PubChem CID | 176934425 |
| Molecular Formula | C11H25F2N |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.20 |
| IUPAC Name | 2,2-difluoro-N,N,3,4-tetramethylpentan-1-amine;ethane |
| SMILES | CC.CC(C)C(C)C(F)(F)CN(C)C |
| InChI | InChI=1S/C9H19F2N.C2H6/c1-7(2)8(3)9(10,11)6-12(4)5;1-2/h7-8H,6H2,1-5H3;1-2H3 |
| InChIKey | YHEXILXWSBIZST-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |