C18H32N2 — CID 176934502
(1Z)-N-buta-1,3-dien-2-yl-1-(1,2,3,6-tetrahydropyridin-5-yl)penta-1,4-dien-1-amine;ethane (PubChem CID 176934502) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is (1Z)-N-buta-1,3-dien-2-yl-1-(1,2,3,6-tetrahydropyridin-5-yl)penta-1,4-dien-1-amine;ethane.
| Compound Name | (1Z)-N-buta-1,3-dien-2-yl-1-(1,2,3,6-tetrahydropyridin-5-yl)penta-1,4-dien-1-amine;ethane |
|---|---|
| PubChem CID | 176934502 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | (1Z)-N-buta-1,3-dien-2-yl-1-(1,2,3,6-tetrahydropyridin-5-yl)penta-1,4-dien-1-amine;ethane |
| SMILES | C=CC/C=C(\NC(=C)C=C)C1=CCCNC1.CC.CC |
| InChI | InChI=1S/C14H20N2.2C2H6/c1-4-6-9-14(16-12(3)5-2)13-8-7-10-15-11-13;2*1-2/h4-5,8-9,15-16H,1-3,6-7,10-11H2;2*1-2H3/b14-9-;; |
| InChIKey | IODLPARDBAUNNR-SLYOBIJPSA-N |
| XLogP | 4.71 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|