C18H20F3N9 — CID 176936440
2-N-[1-cyclopropyl-3-[1-(triazol-2-yl)cyclopropyl]pyrazol-5-yl]-4-N-(1,1,2,2,2-pentadeuterioethyl)-5-(trifluoromethyl)pyrimidine-2,4-diamine (PubChem CID 176936440) has the molecular formula C18H20F3N9 and a molecular weight of 424.45 g/mol. Its IUPAC name is 2-N-[1-cyclopropyl-3-[1-(triazol-2-yl)cyclopropyl]pyrazol-5-yl]-4-N-(1,1,2,2,2-pentadeuterioethyl)-5-(trifluoromethyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[1-cyclopropyl-3-[1-(triazol-2-yl)cyclopropyl]pyrazol-5-yl]-4-N-(1,1,2,2,2-pentadeuterioethyl)-5-(trifluoromethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 176936440 |
| Molecular Formula | C18H20F3N9 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 2-N-[1-cyclopropyl-3-[1-(triazol-2-yl)cyclopropyl]pyrazol-5-yl]-4-N-(1,1,2,2,2-pentadeuterioethyl)-5-(trifluoromethyl)pyrimidine-2,4-diamine |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])Nc1nc(Nc2cc(C3(n4nccn4)CC3)nn2C2CC2)ncc1C(F)(F)F |
| InChI | InChI=1S/C18H20F3N9/c1-2-22-15-12(18(19,20)21)10-23-16(27-15)26-14-9-13(28-29(14)11-3-4-11)17(5-6-17)30-24-7-8-25-30/h7-11H,2-6H2,1H3,(H2,22,23,26,27)/i1D3,2D2 |
| InChIKey | ONAXCAASLFLSEM-ZBJDZAJPSA-N |
| XLogP | 3.33 |
| TPSA | 98.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |