C44H36N2O5 — CID 176936679
ethane;6-[2-[(2Z,4Z)-6-methylidene-1-(3-phenylphenyl)-1-benzazocin-8-yl]carbazol-9-yl]benzene-1,2,3,4,5-pentol (PubChem CID 176936679) has the molecular formula C44H36N2O5 and a molecular weight of 672.78 g/mol. Its IUPAC name is ethane;6-[2-[(2Z,4Z)-6-methylidene-1-(3-phenylphenyl)-1-benzazocin-8-yl]carbazol-9-yl]benzene-1,2,3,4,5-pentol.
| Compound Name | ethane;6-[2-[(2Z,4Z)-6-methylidene-1-(3-phenylphenyl)-1-benzazocin-8-yl]carbazol-9-yl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 176936679 |
| Molecular Formula | C44H36N2O5 |
| Molecular Weight | 672.78 g/mol |
| Exact Mass | 672.26 |
| IUPAC Name | ethane;6-[2-[(2Z,4Z)-6-methylidene-1-(3-phenylphenyl)-1-benzazocin-8-yl]carbazol-9-yl]benzene-1,2,3,4,5-pentol |
| SMILES | C=C1/C=C\C=C/N(c2cccc(-c3ccccc3)c2)c2ccc(-c3ccc4c5ccccc5n(-c5c(O)c(O)c(O)c(O)c5O)c4c3)cc21.CC |
| InChI | InChI=1S/C42H30N2O5.C2H6/c1-25-10-7-8-21-43(30-14-9-13-27(22-30)26-11-3-2-4-12-26)34-20-18-28(23-33(25)34)29-17-19-32-31-15-5-6-16-35(31)44(36(32)24-29)37-38(45)40(47)42(49)41(48)39(37)46;1-2/h2-24,45-49H,1H2;1-2H3/b10-7-,21-8-; |
| InChIKey | GNFVEAOKIHVMRQ-JLYMGXKISA-N |
| XLogP | 10.91 |
| TPSA | 109.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.78 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|