About (3Z)-4-fluoro-N-(methylideneamino)hexa-3,5-dien-3-amine
(3Z)-4-fluoro-N-(methylideneamino)hexa-3,5-dien-3-amine (PubChem CID 176936779) has the molecular formula C7H11FN2
and a molecular weight of 142.18 g/mol. Its IUPAC name is (3Z)-4-fluoro-N-(methylideneamino)hexa-3,5-dien-3-amine.
Molecular Properties
| Compound Name | (3Z)-4-fluoro-N-(methylideneamino)hexa-3,5-dien-3-amine |
| PubChem CID | 176936779 |
| Molecular Formula | C7H11FN2 |
| Molecular Weight | 142.18 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | (3Z)-4-fluoro-N-(methylideneamino)hexa-3,5-dien-3-amine |
| SMILES | C=C/C(F)=C(\CC)NN=C |
| InChI | InChI=1S/C7H11FN2/c1-4-6(8)7(5-2)10-9-3/h4,10H,1,3,5H2,2H3/b7-6- |
| InChIKey | DNMHKUGHVMTARO-SREVYHEPSA-N |
| XLogP | 1.97 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.18 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-4-fluoro-N-(methylideneamino)hexa-3,5-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-4-fluoro-N-(methylideneamino)hexa-3,5-dien-3-amine?
The IUPAC name of (3Z)-4-fluoro-N-(methylideneamino)hexa-3,5-dien-3-amine (CID 176936779) is (3Z)-4-fluoro-N-(methylideneamino)hexa-3,5-dien-3-amine.
What is the SMILES notation for (3Z)-4-fluoro-N-(methylideneamino)hexa-3,5-dien-3-amine?
The canonical SMILES for (3Z)-4-fluoro-N-(methylideneamino)hexa-3,5-dien-3-amine is C=C/C(F)=C(\CC)NN=C.
What is the InChIKey of (3Z)-4-fluoro-N-(methylideneamino)hexa-3,5-dien-3-amine?
The InChIKey is DNMHKUGHVMTARO-SREVYHEPSA-N. The full InChI is InChI=1S/C7H11FN2/c1-4-6(8)7(5-2)10-9-3/h4,10H,1,3,5H2,2H3/b7-6-.
What are the key properties of (3Z)-4-fluoro-N-(methylideneamino)hexa-3,5-dien-3-amine?
(3Z)-4-fluoro-N-(methylideneamino)hexa-3,5-dien-3-amine has a molecular weight of 142.18 g/mol, XLogP of 1.97, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-4-fluoro-N-(methylideneamino)hexa-3,5-dien-3-amine is sourced from PubChem (CID 176936779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).