About ethane;2,2,2-trifluoro-N-(6-hydroxyhexyl)acetamide
ethane;2,2,2-trifluoro-N-(6-hydroxyhexyl)acetamide (PubChem CID 176937290) has the molecular formula C10H20F3NO2
and a molecular weight of 243.27 g/mol. Its IUPAC name is ethane;2,2,2-trifluoro-N-(6-hydroxyhexyl)acetamide.
Molecular Properties
| Compound Name | ethane;2,2,2-trifluoro-N-(6-hydroxyhexyl)acetamide |
| PubChem CID | 176937290 |
| Molecular Formula | C10H20F3NO2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | ethane;2,2,2-trifluoro-N-(6-hydroxyhexyl)acetamide |
| SMILES | CC.O=C(NCCCCCCO)C(F)(F)F |
| InChI | InChI=1S/C8H14F3NO2.C2H6/c9-8(10,11)7(14)12-5-3-1-2-4-6-13;1-2/h13H,1-6H2,(H,12,14);1-2H3 |
| InChIKey | RPQLAMLRJHAKKB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;2,2,2-trifluoro-N-(6-hydroxyhexyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2,2,2-trifluoro-N-(6-hydroxyhexyl)acetamide?
The IUPAC name of ethane;2,2,2-trifluoro-N-(6-hydroxyhexyl)acetamide (CID 176937290) is ethane;2,2,2-trifluoro-N-(6-hydroxyhexyl)acetamide.
What is the SMILES notation for ethane;2,2,2-trifluoro-N-(6-hydroxyhexyl)acetamide?
The canonical SMILES for ethane;2,2,2-trifluoro-N-(6-hydroxyhexyl)acetamide is CC.O=C(NCCCCCCO)C(F)(F)F.
What is the InChIKey of ethane;2,2,2-trifluoro-N-(6-hydroxyhexyl)acetamide?
The InChIKey is RPQLAMLRJHAKKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F3NO2.C2H6/c9-8(10,11)7(14)12-5-3-1-2-4-6-13;1-2/h13H,1-6H2,(H,12,14);1-2H3.
What are the key properties of ethane;2,2,2-trifluoro-N-(6-hydroxyhexyl)acetamide?
ethane;2,2,2-trifluoro-N-(6-hydroxyhexyl)acetamide has a molecular weight of 243.27 g/mol, XLogP of 2.24, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2,2,2-trifluoro-N-(6-hydroxyhexyl)acetamide is sourced from PubChem (CID 176937290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).