C28H26F2N6O — CID 176937679
2-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(8-ethynyl-7-fluoronaphthalen-1-yl)-8-fluoropyrido[4,3-d]pyrimidin-2-yl]oxy-N-methylethanamine (PubChem CID 176937679) has the molecular formula C28H26F2N6O and a molecular weight of 500.55 g/mol. Its IUPAC name is 2-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(8-ethynyl-7-fluoronaphthalen-1-yl)-8-fluoropyrido[4,3-d]pyrimidin-2-yl]oxy-N-methylethanamine.
| Compound Name | 2-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(8-ethynyl-7-fluoronaphthalen-1-yl)-8-fluoropyrido[4,3-d]pyrimidin-2-yl]oxy-N-methylethanamine |
|---|---|
| PubChem CID | 176937679 |
| Molecular Formula | C28H26F2N6O |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 2-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(8-ethynyl-7-fluoronaphthalen-1-yl)-8-fluoropyrido[4,3-d]pyrimidin-2-yl]oxy-N-methylethanamine |
| SMILES | C#Cc1c(F)ccc2cccc(-c3ncc4c(N5CC6CCC(C5)N6)nc(OCCNC)nc4c3F)c12 |
| InChI | InChI=1S/C28H26F2N6O/c1-3-19-22(29)10-7-16-5-4-6-20(23(16)19)25-24(30)26-21(13-32-25)27(35-28(34-26)37-12-11-31-2)36-14-17-8-9-18(15-36)33-17/h1,4-7,10,13,17-18,31,33H,8-9,11-12,14-15H2,2H3 |
| InChIKey | JSEGCFNQDFQILS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|