C29H35N5O2S — CID 176938002
4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-N-(3-hydroxysulfanylpropyl)-7-(8-methylnaphthalen-1-yl)-6,8-dihydro-5H-1,7-naphthyridine-2-carboxamide (PubChem CID 176938002) has the molecular formula C29H35N5O2S and a molecular weight of 517.70 g/mol. Its IUPAC name is 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-N-(3-hydroxysulfanylpropyl)-7-(8-methylnaphthalen-1-yl)-6,8-dihydro-5H-1,7-naphthyridine-2-carboxamide.
| Compound Name | 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-N-(3-hydroxysulfanylpropyl)-7-(8-methylnaphthalen-1-yl)-6,8-dihydro-5H-1,7-naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 176938002 |
| Molecular Formula | C29H35N5O2S |
| Molecular Weight | 517.70 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-N-(3-hydroxysulfanylpropyl)-7-(8-methylnaphthalen-1-yl)-6,8-dihydro-5H-1,7-naphthyridine-2-carboxamide |
| SMILES | Cc1cccc2cccc(N3CCc4c(N5CC6CCC(C5)N6)cc(C(=O)NCCCSO)nc4C3)c12 |
| InChI | InChI=1S/C29H35N5O2S/c1-19-5-2-6-20-7-3-8-26(28(19)20)33-13-11-23-25(18-33)32-24(29(35)30-12-4-14-37-36)15-27(23)34-16-21-9-10-22(17-34)31-21/h2-3,5-8,15,21-22,31,36H,4,9-14,16-18H2,1H3,(H,30,35) |
| InChIKey | NJISNQKSXNZCGW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.70 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|