About ethane;N'-methyloxamide
ethane;N'-methyloxamide (PubChem CID 176938398) has the molecular formula C5H12N2O2
and a molecular weight of 132.16 g/mol. Its IUPAC name is ethane;N'-methyloxamide.
Molecular Properties
| Compound Name | ethane;N'-methyloxamide |
| PubChem CID | 176938398 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | ethane;N'-methyloxamide |
| SMILES | CC.CNC(=O)C(N)=O |
| InChI | InChI=1S/C3H6N2O2.C2H6/c1-5-3(7)2(4)6;1-2/h1H3,(H2,4,6)(H,5,7);1-2H3 |
| InChIKey | XNWNMQZUJIVRDG-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethane;N'-methyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N'-methyloxamide?
The IUPAC name of ethane;N'-methyloxamide (CID 176938398) is ethane;N'-methyloxamide.
What is the SMILES notation for ethane;N'-methyloxamide?
The canonical SMILES for ethane;N'-methyloxamide is CC.CNC(=O)C(N)=O.
What is the InChIKey of ethane;N'-methyloxamide?
The InChIKey is XNWNMQZUJIVRDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N2O2.C2H6/c1-5-3(7)2(4)6;1-2/h1H3,(H2,4,6)(H,5,7);1-2H3.
What are the key properties of ethane;N'-methyloxamide?
ethane;N'-methyloxamide has a molecular weight of 132.16 g/mol, XLogP of -0.76, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N'-methyloxamide is sourced from PubChem (CID 176938398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).