C25H33N9O2 — CID 176939213
2-[4-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyrazol-1-yl]acetaldehyde;N-methyl-4-[2-(4-methylpiperazin-1-yl)ethoxy]aniline (PubChem CID 176939213) has the molecular formula C25H33N9O2 and a molecular weight of 491.60 g/mol. Its IUPAC name is 2-[4-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyrazol-1-yl]acetaldehyde;N-methyl-4-[2-(4-methylpiperazin-1-yl)ethoxy]aniline.
| Compound Name | 2-[4-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyrazol-1-yl]acetaldehyde;N-methyl-4-[2-(4-methylpiperazin-1-yl)ethoxy]aniline |
|---|---|
| PubChem CID | 176939213 |
| Molecular Formula | C25H33N9O2 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | 2-[4-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyrazol-1-yl]acetaldehyde;N-methyl-4-[2-(4-methylpiperazin-1-yl)ethoxy]aniline |
| SMILES | CNc1ccc(OCCN2CCN(C)CC2)cc1.Nc1nc2cc(-c3cnn(CC=O)c3)ccn2n1 |
| InChI | InChI=1S/C14H23N3O.C11H10N6O/c1-15-13-3-5-14(6-4-13)18-12-11-17-9-7-16(2)8-10-17;12-11-14-10-5-8(1-2-17(10)15-11)9-6-13-16(7-9)3-4-18/h3-6,15H,7-12H2,1-2H3;1-2,4-7H,3H2,(H2,12,15) |
| InChIKey | DMOFMZANDNTFEO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 118.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|