C13H23NO — CID 176939346
3-[[1-(ethoxymethyl)cyclopropyl]methyl]-3-azabicyclo[3.1.1]heptane (PubChem CID 176939346) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 3-[[1-(ethoxymethyl)cyclopropyl]methyl]-3-azabicyclo[3.1.1]heptane.
| Compound Name | 3-[[1-(ethoxymethyl)cyclopropyl]methyl]-3-azabicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 176939346 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 3-[[1-(ethoxymethyl)cyclopropyl]methyl]-3-azabicyclo[3.1.1]heptane |
| SMILES | CCOCC1(CN2CC3CC(C3)C2)CC1 |
| InChI | InChI=1S/C13H23NO/c1-2-15-10-13(3-4-13)9-14-7-11-5-12(6-11)8-14/h11-12H,2-10H2,1H3 |
| InChIKey | YKDIIYBBKMWKJB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |