C31H39F4N7O — CID 176939369
7-[6-amino-4-methyl-3-(trifluoromethyl)-2-pyridinyl]-5-[2-(azepan-3-yl)ethyl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-amine (PubChem CID 176939369) has the molecular formula C31H39F4N7O and a molecular weight of 601.69 g/mol. Its IUPAC name is 7-[6-amino-4-methyl-3-(trifluoromethyl)-2-pyridinyl]-5-[2-(azepan-3-yl)ethyl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-amine.
| Compound Name | 7-[6-amino-4-methyl-3-(trifluoromethyl)-2-pyridinyl]-5-[2-(azepan-3-yl)ethyl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 176939369 |
| Molecular Formula | C31H39F4N7O |
| Molecular Weight | 601.69 g/mol |
| Exact Mass | 601.32 |
| IUPAC Name | 7-[6-amino-4-methyl-3-(trifluoromethyl)-2-pyridinyl]-5-[2-(azepan-3-yl)ethyl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-amine |
| SMILES | Cc1cc(N)nc(-c2cc(CCC3CCCCNC3)c3c(N)nc(OCC45CCCN4CCC5)nc3c2F)c1C(F)(F)F |
| InChI | InChI=1S/C31H39F4N7O/c1-18-14-22(36)39-26(24(18)31(33,34)35)21-15-20(8-7-19-6-2-3-11-38-16-19)23-27(25(21)32)40-29(41-28(23)37)43-17-30-9-4-12-42(30)13-5-10-30/h14-15,19,38H,2-13,16-17H2,1H3,(H2,36,39)(H2,37,40,41) |
| InChIKey | NTCYDNIBNRJOJI-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.69 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |