About (2E)-N-(2-methoxyethyl)penta-2,4-dien-2-amine
(2E)-N-(2-methoxyethyl)penta-2,4-dien-2-amine (PubChem CID 176939783) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is (2E)-N-(2-methoxyethyl)penta-2,4-dien-2-amine.
Molecular Properties
| Compound Name | (2E)-N-(2-methoxyethyl)penta-2,4-dien-2-amine |
| PubChem CID | 176939783 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | (2E)-N-(2-methoxyethyl)penta-2,4-dien-2-amine |
| SMILES | C=C/C=C(\C)NCCOC |
| InChI | InChI=1S/C8H15NO/c1-4-5-8(2)9-6-7-10-3/h4-5,9H,1,6-7H2,2-3H3/b8-5+ |
| InChIKey | BCRNMVVPTJDRKS-VMPITWQZSA-N |
| XLogP | 1.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-N-(2-methoxyethyl)penta-2,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-N-(2-methoxyethyl)penta-2,4-dien-2-amine?
The IUPAC name of (2E)-N-(2-methoxyethyl)penta-2,4-dien-2-amine (CID 176939783) is (2E)-N-(2-methoxyethyl)penta-2,4-dien-2-amine.
What is the SMILES notation for (2E)-N-(2-methoxyethyl)penta-2,4-dien-2-amine?
The canonical SMILES for (2E)-N-(2-methoxyethyl)penta-2,4-dien-2-amine is C=C/C=C(\C)NCCOC.
What is the InChIKey of (2E)-N-(2-methoxyethyl)penta-2,4-dien-2-amine?
The InChIKey is BCRNMVVPTJDRKS-VMPITWQZSA-N. The full InChI is InChI=1S/C8H15NO/c1-4-5-8(2)9-6-7-10-3/h4-5,9H,1,6-7H2,2-3H3/b8-5+.
What are the key properties of (2E)-N-(2-methoxyethyl)penta-2,4-dien-2-amine?
(2E)-N-(2-methoxyethyl)penta-2,4-dien-2-amine has a molecular weight of 141.21 g/mol, XLogP of 1.31, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-N-(2-methoxyethyl)penta-2,4-dien-2-amine is sourced from PubChem (CID 176939783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).