C19H13F4IN7O- — CID 176940063
CID 176940063 (PubChem CID 176940063) has the molecular formula C19H13F4IN7O- and a molecular weight of 558.26 g/mol.
| Compound Name | CID 176940063 |
|---|---|
| PubChem CID | 176940063 |
| Molecular Formula | C19H13F4IN7O- |
| Molecular Weight | 558.26 g/mol |
| Exact Mass | 558.02 |
| IUPAC Name | — |
| SMILES | O=C(Nc1cc(-c2ncc(F)cn2)c(C(F)(F)F)cn1)[C@@H]1C[C@@H]2[I-][C@@H]2N1c1cccnn1 |
| InChI | InChI=1S/C19H13F4IN7O/c20-9-6-26-17(27-7-9)10-4-14(25-8-11(10)19(21,22)23)29-18(32)13-5-12-16(24-12)31(13)15-2-1-3-28-30-15/h1-4,6-8,12-13,16H,5H2,(H,25,29,32)/q-1/t12-,13-,16+/m0/s1 |
| InChIKey | KMEBBMOEBCCRBX-HEHGZKQESA-N |
| XLogP | -0.50 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.26 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|