C24H31ClN8O3 — CID 176940767
(1S,3S,5R)-N-[4-chloro-3-[N'-(methyliminomethyl)carbamimidoyl]phenyl]-3-methyl-1-[5-(morpholin-4-ylmethyl)-1,3,4-oxadiazol-2-yl]-6-azabicyclo[3.1.1]heptane-6-carboxamide (PubChem CID 176940767) has the molecular formula C24H31ClN8O3 and a molecular weight of 515.02 g/mol. Its IUPAC name is (1S,3S,5R)-N-[4-chloro-3-[N'-(methyliminomethyl)carbamimidoyl]phenyl]-3-methyl-1-[5-(morpholin-4-ylmethyl)-1,3,4-oxadiazol-2-yl]-6-azabicyclo[3.1.1]heptane-6-carboxamide.
| Compound Name | (1S,3S,5R)-N-[4-chloro-3-[N'-(methyliminomethyl)carbamimidoyl]phenyl]-3-methyl-1-[5-(morpholin-4-ylmethyl)-1,3,4-oxadiazol-2-yl]-6-azabicyclo[3.1.1]heptane-6-carboxamide |
|---|---|
| PubChem CID | 176940767 |
| Molecular Formula | C24H31ClN8O3 |
| Molecular Weight | 515.02 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | (1S,3S,5R)-N-[4-chloro-3-[N'-(methyliminomethyl)carbamimidoyl]phenyl]-3-methyl-1-[5-(morpholin-4-ylmethyl)-1,3,4-oxadiazol-2-yl]-6-azabicyclo[3.1.1]heptane-6-carboxamide |
| SMILES | C/N=C/N=C(\N)c1cc(NC(=O)N2[C@@H]3C[C@H](C)C[C@@]2(c2nnc(CN4CCOCC4)o2)C3)ccc1Cl |
| InChI | InChI=1S/C24H31ClN8O3/c1-15-9-17-12-24(11-15,22-31-30-20(36-22)13-32-5-7-35-8-6-32)33(17)23(34)29-16-3-4-19(25)18(10-16)21(26)28-14-27-2/h3-4,10,14-15,17H,5-9,11-13H2,1-2H3,(H,29,34)(H2,26,27,28)/t15-,17+,24-/m0/s1 |
| InChIKey | PBTKPCSPYNPMSW-ICKUNSISSA-N |
| XLogP | 2.85 |
| TPSA | 134.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.02 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|