C37H48F4N2O2 — CID 176941725
1-[(4R,6aS)-4,6a-dimethyl-3-prop-2-enyl-4-propyl-2,3,4a,5,6,7,8,9,9a,9b-decahydro-1H-cyclopenta[h]isoquinolin-7-yl]-N-[bis[4-(difluoromethoxy)phenyl]methyl]ethenamine (PubChem CID 176941725) has the molecular formula C37H48F4N2O2 and a molecular weight of 628.80 g/mol. Its IUPAC name is 1-[(4R,6aS)-4,6a-dimethyl-3-prop-2-enyl-4-propyl-2,3,4a,5,6,7,8,9,9a,9b-decahydro-1H-cyclopenta[h]isoquinolin-7-yl]-N-[bis[4-(difluoromethoxy)phenyl]methyl]ethenamine.
| Compound Name | 1-[(4R,6aS)-4,6a-dimethyl-3-prop-2-enyl-4-propyl-2,3,4a,5,6,7,8,9,9a,9b-decahydro-1H-cyclopenta[h]isoquinolin-7-yl]-N-[bis[4-(difluoromethoxy)phenyl]methyl]ethenamine |
|---|---|
| PubChem CID | 176941725 |
| Molecular Formula | C37H48F4N2O2 |
| Molecular Weight | 628.80 g/mol |
| Exact Mass | 628.37 |
| IUPAC Name | 1-[(4R,6aS)-4,6a-dimethyl-3-prop-2-enyl-4-propyl-2,3,4a,5,6,7,8,9,9a,9b-decahydro-1H-cyclopenta[h]isoquinolin-7-yl]-N-[bis[4-(difluoromethoxy)phenyl]methyl]ethenamine |
| SMILES | C=CCC1NCC2C(CC[C@]3(C)C(C(=C)NC(c4ccc(OC(F)F)cc4)c4ccc(OC(F)F)cc4)CCC23)[C@@]1(C)CCC |
| InChI | InChI=1S/C37H48F4N2O2/c1-6-8-32-37(5,20-7-2)31-19-21-36(4)29(17-18-30(36)28(31)22-42-32)23(3)43-33(24-9-13-26(14-10-24)44-34(38)39)25-11-15-27(16-12-25)45-35(40)41/h6,9-16,28-35,42-43H,1,3,7-8,17-22H2,2,4-5H3/t28?,29?,30?,31?,32?,36-,37-/m1/s1 |
| InChIKey | NECCIPZTSAJVHF-HQMZKYKFSA-N |
| XLogP | 9.50 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.80 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|