C28H43FN2O — CID 176941803
(2E,3Z,5Z)-3-(1-cyclohexyloxyethenyl)-2-[1-[[(E)-3-fluoropent-3-en-2-ylidene]amino]-2-methylbutylidene]-N-methylnona-3,5-dien-1-imine (PubChem CID 176941803) has the molecular formula C28H43FN2O and a molecular weight of 442.66 g/mol. Its IUPAC name is (2E,3Z,5Z)-3-(1-cyclohexyloxyethenyl)-2-[1-[[(E)-3-fluoropent-3-en-2-ylidene]amino]-2-methylbutylidene]-N-methylnona-3,5-dien-1-imine.
| Compound Name | (2E,3Z,5Z)-3-(1-cyclohexyloxyethenyl)-2-[1-[[(E)-3-fluoropent-3-en-2-ylidene]amino]-2-methylbutylidene]-N-methylnona-3,5-dien-1-imine |
|---|---|
| PubChem CID | 176941803 |
| Molecular Formula | C28H43FN2O |
| Molecular Weight | 442.66 g/mol |
| Exact Mass | 442.34 |
| IUPAC Name | (2E,3Z,5Z)-3-(1-cyclohexyloxyethenyl)-2-[1-[[(E)-3-fluoropent-3-en-2-ylidene]amino]-2-methylbutylidene]-N-methylnona-3,5-dien-1-imine |
| SMILES | C=C(OC1CCCCC1)C(=C\C=C/CCC)/C(/C=N/C)=C(\N=C(C)\C(F)=C/C)C(C)CC |
| InChI | InChI=1S/C28H43FN2O/c1-8-11-12-16-19-25(23(6)32-24-17-14-13-15-18-24)26(20-30-7)28(21(4)9-2)31-22(5)27(29)10-3/h10,12,16,19-21,24H,6,8-9,11,13-15,17-18H2,1-5,7H3/b16-12-,25-19+,27-10+,28-26-,30-20+,31-22+ |
| InChIKey | FHQKVPREKJQELS-QNPXZJCFSA-N |
| XLogP | 8.47 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.66 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|