About (4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene;ethane;methylcyclopropane
(4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene;ethane;methylcyclopropane (PubChem CID 176941943) has the molecular formula C18H30BrF3O
and a molecular weight of 399.34 g/mol. Its IUPAC name is (4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene;ethane;methylcyclopropane.
Molecular Properties
| Compound Name | (4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene;ethane;methylcyclopropane |
| PubChem CID | 176941943 |
| Molecular Formula | C18H30BrF3O |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | (4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene;ethane;methylcyclopropane |
| SMILES | C=C(CC)/C(Br)=C\C(=C/CCC)OC(F)(F)F.CC.CC1CC1 |
| InChI | InChI=1S/C12H16BrF3O.C4H8.C2H6/c1-4-6-7-10(17-12(14,15)16)8-11(13)9(3)5-2;1-4-2-3-4;1-2/h7-8H,3-6H2,1-2H3;4H,2-3H2,1H3;1-2H3/b10-7+,11-8+;; |
| InChIKey | OQVRIBUBSLMPPW-VHZUSOFISA-N |
| XLogP | 7.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene;ethane;methylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene;ethane;methylcyclopropane?
The IUPAC name of (4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene;ethane;methylcyclopropane (CID 176941943) is (4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene;ethane;methylcyclopropane.
What is the SMILES notation for (4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene;ethane;methylcyclopropane?
The canonical SMILES for (4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene;ethane;methylcyclopropane is C=C(CC)/C(Br)=C\C(=C/CCC)OC(F)(F)F.CC.CC1CC1.
What is the InChIKey of (4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene;ethane;methylcyclopropane?
The InChIKey is OQVRIBUBSLMPPW-VHZUSOFISA-N. The full InChI is InChI=1S/C12H16BrF3O.C4H8.C2H6/c1-4-6-7-10(17-12(14,15)16)8-11(13)9(3)5-2;1-4-2-3-4;1-2/h7-8H,3-6H2,1-2H3;4H,2-3H2,1H3;1-2H3/b10-7+,11-8+;;.
What are the key properties of (4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene;ethane;methylcyclopropane?
(4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene;ethane;methylcyclopropane has a molecular weight of 399.34 g/mol, XLogP of 7.89, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene;ethane;methylcyclopropane is sourced from PubChem (CID 176941943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).