About (4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene
(4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene (PubChem CID 176941944) has the molecular formula C12H16BrF3O
and a molecular weight of 313.16 g/mol. Its IUPAC name is (4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene.
Molecular Properties
| Compound Name | (4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene |
| PubChem CID | 176941944 |
| Molecular Formula | C12H16BrF3O |
| Molecular Weight | 313.16 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | (4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene |
| SMILES | C=C(CC)/C(Br)=C\C(=C/CCC)OC(F)(F)F |
| InChI | InChI=1S/C12H16BrF3O/c1-4-6-7-10(17-12(14,15)16)8-11(13)9(3)5-2/h7-8H,3-6H2,1-2H3/b10-7+,11-8+ |
| InChIKey | JKHIHNLNZHJMOS-AMMQDNIMSA-N |
| XLogP | 5.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.16 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene?
The IUPAC name of (4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene (CID 176941944) is (4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene.
What is the SMILES notation for (4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene?
The canonical SMILES for (4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene is C=C(CC)/C(Br)=C\C(=C/CCC)OC(F)(F)F.
What is the InChIKey of (4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene?
The InChIKey is JKHIHNLNZHJMOS-AMMQDNIMSA-N. The full InChI is InChI=1S/C12H16BrF3O/c1-4-6-7-10(17-12(14,15)16)8-11(13)9(3)5-2/h7-8H,3-6H2,1-2H3/b10-7+,11-8+.
What are the key properties of (4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene?
(4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene has a molecular weight of 313.16 g/mol, XLogP of 5.45, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,6E)-4-bromo-3-methylidene-6-(trifluoromethoxy)deca-4,6-diene is sourced from PubChem (CID 176941944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).