About ethyl 2-[[(1,3-dichloro-2-fluoroprop-2-enylidene)amino]methylidene]-4-methylhex-3-enoate
ethyl 2-[[(1,3-dichloro-2-fluoroprop-2-enylidene)amino]methylidene]-4-methylhex-3-enoate (PubChem CID 176942055) has the molecular formula C13H16Cl2FNO2
and a molecular weight of 308.18 g/mol. Its IUPAC name is ethyl 2-[[(1,3-dichloro-2-fluoroprop-2-enylidene)amino]methylidene]-4-methylhex-3-enoate.
Molecular Properties
| Compound Name | ethyl 2-[[(1,3-dichloro-2-fluoroprop-2-enylidene)amino]methylidene]-4-methylhex-3-enoate |
| PubChem CID | 176942055 |
| Molecular Formula | C13H16Cl2FNO2 |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | ethyl 2-[[(1,3-dichloro-2-fluoroprop-2-enylidene)amino]methylidene]-4-methylhex-3-enoate |
| SMILES | CCOC(=O)C(C=C(C)CC)=C/N=C(\Cl)C(F)=CCl |
| InChI | InChI=1S/C13H16Cl2FNO2/c1-4-9(3)6-10(13(18)19-5-2)8-17-12(15)11(16)7-14/h6-8H,4-5H2,1-3H3/b9-6?,10-8?,11-7?,17-12- |
| InChIKey | XIDUKPWUTZTWQO-SDJNIPCASA-N |
| XLogP | 4.48 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[[(1,3-dichloro-2-fluoroprop-2-enylidene)amino]methylidene]-4-methylhex-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[(1,3-dichloro-2-fluoroprop-2-enylidene)amino]methylidene]-4-methylhex-3-enoate?
The IUPAC name of ethyl 2-[[(1,3-dichloro-2-fluoroprop-2-enylidene)amino]methylidene]-4-methylhex-3-enoate (CID 176942055) is ethyl 2-[[(1,3-dichloro-2-fluoroprop-2-enylidene)amino]methylidene]-4-methylhex-3-enoate.
What is the SMILES notation for ethyl 2-[[(1,3-dichloro-2-fluoroprop-2-enylidene)amino]methylidene]-4-methylhex-3-enoate?
The canonical SMILES for ethyl 2-[[(1,3-dichloro-2-fluoroprop-2-enylidene)amino]methylidene]-4-methylhex-3-enoate is CCOC(=O)C(C=C(C)CC)=C/N=C(\Cl)C(F)=CCl.
What is the InChIKey of ethyl 2-[[(1,3-dichloro-2-fluoroprop-2-enylidene)amino]methylidene]-4-methylhex-3-enoate?
The InChIKey is XIDUKPWUTZTWQO-SDJNIPCASA-N. The full InChI is InChI=1S/C13H16Cl2FNO2/c1-4-9(3)6-10(13(18)19-5-2)8-17-12(15)11(16)7-14/h6-8H,4-5H2,1-3H3/b9-6?,10-8?,11-7?,17-12-.
What are the key properties of ethyl 2-[[(1,3-dichloro-2-fluoroprop-2-enylidene)amino]methylidene]-4-methylhex-3-enoate?
ethyl 2-[[(1,3-dichloro-2-fluoroprop-2-enylidene)amino]methylidene]-4-methylhex-3-enoate has a molecular weight of 308.18 g/mol, XLogP of 4.48, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[(1,3-dichloro-2-fluoroprop-2-enylidene)amino]methylidene]-4-methylhex-3-enoate is sourced from PubChem (CID 176942055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).