About (3-methyloxetan-3-yl) N,N-diethylcarbamate
(3-methyloxetan-3-yl) N,N-diethylcarbamate (PubChem CID 176942079) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is (3-methyloxetan-3-yl) N,N-diethylcarbamate.
Molecular Properties
| Compound Name | (3-methyloxetan-3-yl) N,N-diethylcarbamate |
| PubChem CID | 176942079 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | (3-methyloxetan-3-yl) N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)OC1(C)COC1 |
| InChI | InChI=1S/C9H17NO3/c1-4-10(5-2)8(11)13-9(3)6-12-7-9/h4-7H2,1-3H3 |
| InChIKey | IVMACPMABUJVGZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-methyloxetan-3-yl) N,N-diethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyloxetan-3-yl) N,N-diethylcarbamate?
The IUPAC name of (3-methyloxetan-3-yl) N,N-diethylcarbamate (CID 176942079) is (3-methyloxetan-3-yl) N,N-diethylcarbamate.
What is the SMILES notation for (3-methyloxetan-3-yl) N,N-diethylcarbamate?
The canonical SMILES for (3-methyloxetan-3-yl) N,N-diethylcarbamate is CCN(CC)C(=O)OC1(C)COC1.
What is the InChIKey of (3-methyloxetan-3-yl) N,N-diethylcarbamate?
The InChIKey is IVMACPMABUJVGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3/c1-4-10(5-2)8(11)13-9(3)6-12-7-9/h4-7H2,1-3H3.
What are the key properties of (3-methyloxetan-3-yl) N,N-diethylcarbamate?
(3-methyloxetan-3-yl) N,N-diethylcarbamate has a molecular weight of 187.24 g/mol, XLogP of 1.25, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyloxetan-3-yl) N,N-diethylcarbamate is sourced from PubChem (CID 176942079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).