C28H28F3N5O4 — CID 176942454
1-[7-[5-hydroxy-6-(trifluoromethyl)pyridine-3-carbonyl]-3-(4-propan-2-ylphenyl)-13-oxa-2,3,7,10-tetrazatricyclo[6.5.1.04,14]tetradeca-1,4(14)-dien-10-yl]prop-2-en-1-one (PubChem CID 176942454) has the molecular formula C28H28F3N5O4 and a molecular weight of 555.56 g/mol. Its IUPAC name is 1-[7-[5-hydroxy-6-(trifluoromethyl)pyridine-3-carbonyl]-3-(4-propan-2-ylphenyl)-13-oxa-2,3,7,10-tetrazatricyclo[6.5.1.04,14]tetradeca-1,4(14)-dien-10-yl]prop-2-en-1-one.
| Compound Name | 1-[7-[5-hydroxy-6-(trifluoromethyl)pyridine-3-carbonyl]-3-(4-propan-2-ylphenyl)-13-oxa-2,3,7,10-tetrazatricyclo[6.5.1.04,14]tetradeca-1,4(14)-dien-10-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 176942454 |
| Molecular Formula | C28H28F3N5O4 |
| Molecular Weight | 555.56 g/mol |
| Exact Mass | 555.21 |
| IUPAC Name | 1-[7-[5-hydroxy-6-(trifluoromethyl)pyridine-3-carbonyl]-3-(4-propan-2-ylphenyl)-13-oxa-2,3,7,10-tetrazatricyclo[6.5.1.04,14]tetradeca-1,4(14)-dien-10-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCOc2nn(-c3ccc(C(C)C)cc3)c3c2C(C1)N(C(=O)c1cnc(C(F)(F)F)c(O)c1)CC3 |
| InChI | InChI=1S/C28H28F3N5O4/c1-4-23(38)34-11-12-40-26-24-20(36(33-26)19-7-5-17(6-8-19)16(2)3)9-10-35(21(24)15-34)27(39)18-13-22(37)25(32-14-18)28(29,30)31/h4-8,13-14,16,21,37H,1,9-12,15H2,2-3H3 |
| InChIKey | XMUQZHYVWFOFLT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|