C12H22N2 — CID 176942528
1-(6-ethyl-1-methyl-3,6-dihydro-2H-pyridin-5-yl)butan-1-imine (PubChem CID 176942528) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 1-(6-ethyl-1-methyl-3,6-dihydro-2H-pyridin-5-yl)butan-1-imine.
| Compound Name | 1-(6-ethyl-1-methyl-3,6-dihydro-2H-pyridin-5-yl)butan-1-imine |
|---|---|
| PubChem CID | 176942528 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 1-(6-ethyl-1-methyl-3,6-dihydro-2H-pyridin-5-yl)butan-1-imine |
| SMILES | [H]/N=C(\CCC)C1=CCCN(C)C1CC |
| InChI | InChI=1S/C12H22N2/c1-4-7-11(13)10-8-6-9-14(3)12(10)5-2/h8,12-13H,4-7,9H2,1-3H3/b13-11+ |
| InChIKey | WZNHIFIFOIENKO-ACCUITESSA-N |
| XLogP | 2.85 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|