C14H22N2O4 — CID 176942575
tert-butyl 5-(3-methoxy-3-oxopropanimidoyl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 176942575) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is tert-butyl 5-(3-methoxy-3-oxopropanimidoyl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 5-(3-methoxy-3-oxopropanimidoyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 176942575 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | tert-butyl 5-(3-methoxy-3-oxopropanimidoyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | [H]/N=C(\CC(=O)OC)C1=CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H22N2O4/c1-14(2,3)20-13(18)16-7-5-6-10(9-16)11(15)8-12(17)19-4/h6,15H,5,7-9H2,1-4H3/b15-11+ |
| InChIKey | CXEWBOMUBBHLEW-RVDMUPIBSA-N |
| XLogP | 2.14 |
| TPSA | 79.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|