C32H41F2N5O2 — CID 176942863
[4-amino-6-(1,1-difluoro-2-methylprop-2-enyl)piperidin-3-yl]-[3-(4-cyclopentyl-2-hydroxyphenyl)-10-methylidene-2,3,7-triazatricyclo[6.4.1.04,13]trideca-1,4(13)-dien-7-yl]methanone (PubChem CID 176942863) has the molecular formula C32H41F2N5O2 and a molecular weight of 565.71 g/mol. Its IUPAC name is [4-amino-6-(1,1-difluoro-2-methylprop-2-enyl)piperidin-3-yl]-[3-(4-cyclopentyl-2-hydroxyphenyl)-10-methylidene-2,3,7-triazatricyclo[6.4.1.04,13]trideca-1,4(13)-dien-7-yl]methanone.
| Compound Name | [4-amino-6-(1,1-difluoro-2-methylprop-2-enyl)piperidin-3-yl]-[3-(4-cyclopentyl-2-hydroxyphenyl)-10-methylidene-2,3,7-triazatricyclo[6.4.1.04,13]trideca-1,4(13)-dien-7-yl]methanone |
|---|---|
| PubChem CID | 176942863 |
| Molecular Formula | C32H41F2N5O2 |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 565.32 |
| IUPAC Name | [4-amino-6-(1,1-difluoro-2-methylprop-2-enyl)piperidin-3-yl]-[3-(4-cyclopentyl-2-hydroxyphenyl)-10-methylidene-2,3,7-triazatricyclo[6.4.1.04,13]trideca-1,4(13)-dien-7-yl]methanone |
| SMILES | C=C1CCc2nn(-c3ccc(C4CCCC4)cc3O)c3c2C(C1)N(C(=O)C1CNC(C(F)(F)C(=C)C)CC1N)CC3 |
| InChI | InChI=1S/C32H41F2N5O2/c1-18(2)32(33,34)29-16-23(35)22(17-36-29)31(41)38-13-12-26-30-24(10-8-19(3)14-27(30)38)37-39(26)25-11-9-21(15-28(25)40)20-6-4-5-7-20/h9,11,15,20,22-23,27,29,36,40H,1,3-8,10,12-14,16-17,35H2,2H3 |
| InChIKey | PBHGHKSGLFXEAQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 96.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|